C12H15F9O3S2 — CID 162622927
2-methylsulfanylbicyclo[2.2.1]heptane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 162622927) has the molecular formula C12H15F9O3S2 and a molecular weight of 442.37 g/mol. Its IUPAC name is 2-methylsulfanylbicyclo[2.2.1]heptane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 2-methylsulfanylbicyclo[2.2.1]heptane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 162622927 |
| Molecular Formula | C12H15F9O3S2 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 2-methylsulfanylbicyclo[2.2.1]heptane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | CSC1CC2CCC1C2.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H14S.C4HF9O3S/c1-9-8-5-6-2-3-7(8)4-6;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h6-8H,2-5H2,1H3;(H,14,15,16) |
| InChIKey | QAJYPCILUFIGSC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|