C14H17FN3O7P — CID 162624738
(1R)-3-[[amino-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]amino]-4-fluorocyclopent-3-ene-1-carboxylic acid (PubChem CID 162624738) has the molecular formula C14H17FN3O7P and a molecular weight of 389.28 g/mol. Its IUPAC name is (1R)-3-[[amino-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]amino]-4-fluorocyclopent-3-ene-1-carboxylic acid.
| Compound Name | (1R)-3-[[amino-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]amino]-4-fluorocyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 162624738 |
| Molecular Formula | C14H17FN3O7P |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (1R)-3-[[amino-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylidene]amino]-4-fluorocyclopent-3-ene-1-carboxylic acid |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C(N)=N/C2=C(F)C[C@H](C(=O)O)C2)c1O |
| InChI | InChI=1S/C14H17FN3O7P/c1-6-12(19)11(8(4-17-6)5-25-26(22,23)24)13(16)18-10-3-7(14(20)21)2-9(10)15/h4,7,19H,2-3,5H2,1H3,(H2,16,18)(H,20,21)(H2,22,23,24)/t7-/m0/s1 |
| InChIKey | CRYMRBUUWUJRJH-ZETCQYMHSA-N |
| XLogP | 1.09 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|