C12H18NO5P — CID 163691742
[4-[(1R)-2-ethylcyclopropyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 163691742) has the molecular formula C12H18NO5P and a molecular weight of 287.25 g/mol. Its IUPAC name is [4-[(1R)-2-ethylcyclopropyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [4-[(1R)-2-ethylcyclopropyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163691742 |
| Molecular Formula | C12H18NO5P |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [4-[(1R)-2-ethylcyclopropyl]-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | CCC1C[C@H]1c1c(COP(=O)(O)O)cnc(C)c1O |
| InChI | InChI=1S/C12H18NO5P/c1-3-8-4-10(8)11-9(6-18-19(15,16)17)5-13-7(2)12(11)14/h5,8,10,14H,3-4,6H2,1-2H3,(H2,15,16,17)/t8?,10-/m1/s1 |
| InChIKey | JTNRLYDZWIYJRQ-LHIURRSHSA-N |
| XLogP | 2.22 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|