C19H19N3O3S — CID 162627278
N-(2,3-dimethyl-5-phenylimidazol-4-yl)-3-methylsulfonylbenzamide (PubChem CID 162627278) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-phenylimidazol-4-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(2,3-dimethyl-5-phenylimidazol-4-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 162627278 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(2,3-dimethyl-5-phenylimidazol-4-yl)-3-methylsulfonylbenzamide |
| SMILES | Cc1nc(-c2ccccc2)c(NC(=O)c2cccc(S(C)(=O)=O)c2)n1C |
| InChI | InChI=1S/C19H19N3O3S/c1-13-20-17(14-8-5-4-6-9-14)18(22(13)2)21-19(23)15-10-7-11-16(12-15)26(3,24)25/h4-12H,1-3H3,(H,21,23) |
| InChIKey | RCNPIDKVFRKFES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |