C17H28N4O — CID 162633683
(3aR,6aS)-5-N-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine (PubChem CID 162633683) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (3aR,6aS)-5-N-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine.
| Compound Name | (3aR,6aS)-5-N-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
|---|---|
| PubChem CID | 162633683 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (3aR,6aS)-5-N-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)c3nnc(C4CCC4)o3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H28N4O/c1-20(2)14-7-12-9-15(10-13(12)8-14)21(3)17-19-18-16(22-17)11-5-4-6-11/h11-15H,4-10H2,1-3H3/t12-,13+,14?,15? |
| InChIKey | GSCHSYNGZTWKJH-DGKWVBSXSA-N |
| XLogP | 2.89 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |