C14H22N3O7S+ — CID 162639687
[(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium (PubChem CID 162639687) has the molecular formula C14H22N3O7S+ and a molecular weight of 376.41 g/mol. Its IUPAC name is [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium.
| Compound Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium |
|---|---|
| PubChem CID | 162639687 |
| Molecular Formula | C14H22N3O7S+ |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium |
| SMILES | C[S+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N3O7S/c1-25(5-3-7(15)13(21)22)6-8-10(19)11(20)12(24-8)17-4-2-9(18)16-14(17)23/h2,4,7-8,10-12,19-20H,3,5-6,15H2,1H3,(H-,16,18,21,22,23)/p+1/t7-,8+,10+,11+,12+,25?/m0/s1 |
| InChIKey | IBNVLXGDUJYQHQ-OJANYLEWSA-O |
| XLogP | -2.79 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|