C27H29ClFNO2 — CID 162640322
3-[4-[(Z)-1-(4-chlorophenyl)-2-(4-fluoro-3-methoxyphenyl)prop-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 162640322) has the molecular formula C27H29ClFNO2 and a molecular weight of 453.99 g/mol. Its IUPAC name is 3-[4-[(Z)-1-(4-chlorophenyl)-2-(4-fluoro-3-methoxyphenyl)prop-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[(Z)-1-(4-chlorophenyl)-2-(4-fluoro-3-methoxyphenyl)prop-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 162640322 |
| Molecular Formula | C27H29ClFNO2 |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-[4-[(Z)-1-(4-chlorophenyl)-2-(4-fluoro-3-methoxyphenyl)prop-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1cc(/C(C)=C(\c2ccc(Cl)cc2)c2ccc(OCCCN(C)C)cc2)ccc1F |
| InChI | InChI=1S/C27H29ClFNO2/c1-19(22-10-15-25(29)26(18-22)31-4)27(20-6-11-23(28)12-7-20)21-8-13-24(14-9-21)32-17-5-16-30(2)3/h6-15,18H,5,16-17H2,1-4H3/b27-19+ |
| InChIKey | SVRPWANZTUTBOI-ZXVVBBHZSA-N |
| XLogP | 6.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|