C18H15Cl2FN2Se — CID 162644406
1-[2-(2,4-dichlorophenyl)-2-[(3-fluorophenyl)methylselanyl]ethyl]imidazole (PubChem CID 162644406) has the molecular formula C18H15Cl2FN2Se and a molecular weight of 428.20 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-[(3-fluorophenyl)methylselanyl]ethyl]imidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-[(3-fluorophenyl)methylselanyl]ethyl]imidazole |
|---|---|
| PubChem CID | 162644406 |
| Molecular Formula | C18H15Cl2FN2Se |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(3-fluorophenyl)methylselanyl]ethyl]imidazole |
| SMILES | Fc1cccc(C[Se]C(Cn2ccnc2)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H15Cl2FN2Se/c19-14-4-5-16(17(20)9-14)18(10-23-7-6-22-12-23)24-11-13-2-1-3-15(21)8-13/h1-9,12,18H,10-11H2 |
| InChIKey | OCOOBEHTQOJGBK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|