C33H31NO4 — CID 162645444
(3E,5E)-3,5-bis[(4-hydroxy-3-prop-2-enylphenyl)methylidene]-1-(4-methylbenzoyl)piperidin-4-one (PubChem CID 162645444) has the molecular formula C33H31NO4 and a molecular weight of 505.61 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-hydroxy-3-prop-2-enylphenyl)methylidene]-1-(4-methylbenzoyl)piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(4-hydroxy-3-prop-2-enylphenyl)methylidene]-1-(4-methylbenzoyl)piperidin-4-one |
|---|---|
| PubChem CID | 162645444 |
| Molecular Formula | C33H31NO4 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-hydroxy-3-prop-2-enylphenyl)methylidene]-1-(4-methylbenzoyl)piperidin-4-one |
| SMILES | C=CCc1cc(/C=C2\CN(C(=O)c3ccc(C)cc3)C/C(=C\c3ccc(O)c(CC=C)c3)C2=O)ccc1O |
| InChI | InChI=1S/C33H31NO4/c1-4-6-26-16-23(10-14-30(26)35)18-28-20-34(33(38)25-12-8-22(3)9-13-25)21-29(32(28)37)19-24-11-15-31(36)27(17-24)7-5-2/h4-5,8-19,35-36H,1-2,6-7,20-21H2,3H3/b28-18+,29-19+ |
| InChIKey | FJMARUHHWKTTMD-UOSOPFLXSA-N |
| XLogP | 6.06 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|