C34H32FN5O7 — CID 162646816
N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 162646816) has the molecular formula C34H32FN5O7 and a molecular weight of 641.66 g/mol. Its IUPAC name is N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 162646816 |
| Molecular Formula | C34H32FN5O7 |
| Molecular Weight | 641.66 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4nn(-c5ccccc5)cc(C)c4=O)cc3F)ccnc2cc1OCCCCCC(=O)NO |
| InChI | InChI=1S/C34H32FN5O7/c1-21-20-40(23-9-5-3-6-10-23)38-32(33(21)42)34(43)37-22-12-13-28(25(35)17-22)47-27-14-15-36-26-19-30(29(45-2)18-24(26)27)46-16-8-4-7-11-31(41)39-44/h3,5-6,9-10,12-15,17-20,44H,4,7-8,11,16H2,1-2H3,(H,37,43)(H,39,41) |
| InChIKey | GTISQOWXDPCOKH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|