C34H31F2N5O7 — CID 162672105
N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-(2-fluorophenyl)-5-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 162672105) has the molecular formula C34H31F2N5O7 and a molecular weight of 659.65 g/mol. Its IUPAC name is N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-(2-fluorophenyl)-5-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-(2-fluorophenyl)-5-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 162672105 |
| Molecular Formula | C34H31F2N5O7 |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | N-[3-fluoro-4-[7-[6-(hydroxyamino)-6-oxohexoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-(2-fluorophenyl)-5-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4nn(-c5ccccc5F)cc(C)c4=O)cc3F)ccnc2cc1OCCCCCC(=O)NO |
| InChI | InChI=1S/C34H31F2N5O7/c1-20-19-41(26-9-6-5-8-23(26)35)39-32(33(20)43)34(44)38-21-11-12-28(24(36)16-21)48-27-13-14-37-25-18-30(29(46-2)17-22(25)27)47-15-7-3-4-10-31(42)40-45/h5-6,8-9,11-14,16-19,45H,3-4,7,10,15H2,1-2H3,(H,38,44)(H,40,42) |
| InChIKey | KMQLENVKJJQSNV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|