C32H28FN5O7 — CID 162663981
N-[3-fluoro-4-[7-[4-(hydroxyamino)-4-oxobutoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 162663981) has the molecular formula C32H28FN5O7 and a molecular weight of 613.60 g/mol. Its IUPAC name is N-[3-fluoro-4-[7-[4-(hydroxyamino)-4-oxobutoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[7-[4-(hydroxyamino)-4-oxobutoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 162663981 |
| Molecular Formula | C32H28FN5O7 |
| Molecular Weight | 613.60 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | N-[3-fluoro-4-[7-[4-(hydroxyamino)-4-oxobutoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4nn(-c5ccccc5)cc(C)c4=O)cc3F)ccnc2cc1OCCCC(=O)NO |
| InChI | InChI=1S/C32H28FN5O7/c1-19-18-38(21-7-4-3-5-8-21)36-30(31(19)40)32(41)35-20-10-11-26(23(33)15-20)45-25-12-13-34-24-17-28(27(43-2)16-22(24)25)44-14-6-9-29(39)37-42/h3-5,7-8,10-13,15-18,42H,6,9,14H2,1-2H3,(H,35,41)(H,37,39) |
| InChIKey | GGMHJYFCJKFZJI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|