C31H27N5O7 — CID 162645893
N-[4-[7-[2-(hydroxyamino)-2-oxoethoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-1-(2-methylphenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 162645893) has the molecular formula C31H27N5O7 and a molecular weight of 581.59 g/mol. Its IUPAC name is N-[4-[7-[2-(hydroxyamino)-2-oxoethoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-1-(2-methylphenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-[7-[2-(hydroxyamino)-2-oxoethoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-1-(2-methylphenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 162645893 |
| Molecular Formula | C31H27N5O7 |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | N-[4-[7-[2-(hydroxyamino)-2-oxoethoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-5-methyl-1-(2-methylphenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4nn(-c5ccccc5C)cc(C)c4=O)cc3)ccnc2cc1OCC(=O)NO |
| InChI | InChI=1S/C31H27N5O7/c1-18-6-4-5-7-24(18)36-16-19(2)30(38)29(34-36)31(39)33-20-8-10-21(11-9-20)43-25-12-13-32-23-15-27(42-17-28(37)35-40)26(41-3)14-22(23)25/h4-16,40H,17H2,1-3H3,(H,33,39)(H,35,37) |
| InChIKey | SRHOIBULWVUJNX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|