C16H20Br2N2O4 — CID 162655746
7-(2,4-dibromophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)heptanamide (PubChem CID 162655746) has the molecular formula C16H20Br2N2O4 and a molecular weight of 464.15 g/mol. Its IUPAC name is 7-(2,4-dibromophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)heptanamide.
| Compound Name | 7-(2,4-dibromophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)heptanamide |
|---|---|
| PubChem CID | 162655746 |
| Molecular Formula | C16H20Br2N2O4 |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | 7-(2,4-dibromophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)heptanamide |
| SMILES | O=C(CCCCCCOc1ccc(Br)cc1Br)NN1CCOC1=O |
| InChI | InChI=1S/C16H20Br2N2O4/c17-12-6-7-14(13(18)11-12)23-9-4-2-1-3-5-15(21)19-20-8-10-24-16(20)22/h6-7,11H,1-5,8-10H2,(H,19,21) |
| InChIKey | HYDVVJLLAMSPSJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|