C21H19ClF2O5S — CID 162655886
(2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-hydroxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 162655886) has the molecular formula C21H19ClF2O5S and a molecular weight of 456.89 g/mol. Its IUPAC name is (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-hydroxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-hydroxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 162655886 |
| Molecular Formula | C21H19ClF2O5S |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-hydroxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3cc4ccccc4s3)c(Cl)cc2O)[C@H](O)[C@@H](O)C1(F)F |
| InChI | InChI=1S/C21H19ClF2O5S/c22-14-8-15(26)13(19-18(27)20(28)21(23,24)17(9-25)29-19)7-11(14)6-12-5-10-3-1-2-4-16(10)30-12/h1-5,7-8,17-20,25-28H,6,9H2/t17-,18+,19+,20-/m1/s1 |
| InChIKey | URGFAONHCWSEQV-FUMNGEBKSA-N |
| XLogP | 3.64 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |