C28H28ClN7O2 — CID 162657115
(3aS,7aR)-5-[[3-(4-chlorophenoxy)phenyl]methyl]-N-[6-(triazol-2-yl)-3-pyridinyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide (PubChem CID 162657115) has the molecular formula C28H28ClN7O2 and a molecular weight of 530.03 g/mol. Its IUPAC name is (3aS,7aR)-5-[[3-(4-chlorophenoxy)phenyl]methyl]-N-[6-(triazol-2-yl)-3-pyridinyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide.
| Compound Name | (3aS,7aR)-5-[[3-(4-chlorophenoxy)phenyl]methyl]-N-[6-(triazol-2-yl)-3-pyridinyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162657115 |
| Molecular Formula | C28H28ClN7O2 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (3aS,7aR)-5-[[3-(4-chlorophenoxy)phenyl]methyl]-N-[6-(triazol-2-yl)-3-pyridinyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-n2nccn2)nc1)N1C[C@@H]2CCN(Cc3cccc(Oc4ccc(Cl)cc4)c3)C[C@H]2C1 |
| InChI | InChI=1S/C28H28ClN7O2/c29-23-4-7-25(8-5-23)38-26-3-1-2-20(14-26)16-34-13-10-21-18-35(19-22(21)17-34)28(37)33-24-6-9-27(30-15-24)36-31-11-12-32-36/h1-9,11-12,14-15,21-22H,10,13,16-19H2,(H,33,37)/t21-,22-/m0/s1 |
| InChIKey | VULJMQFOVWXGLK-VXKWHMMOSA-N |
| XLogP | 5.09 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |