C26H44O6P2 — CID 162660194
1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethyl]-3-tert-butyl-5-ethynylbenzene (PubChem CID 162660194) has the molecular formula C26H44O6P2 and a molecular weight of 514.58 g/mol. Its IUPAC name is 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethyl]-3-tert-butyl-5-ethynylbenzene.
| Compound Name | 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethyl]-3-tert-butyl-5-ethynylbenzene |
|---|---|
| PubChem CID | 162660194 |
| Molecular Formula | C26H44O6P2 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethyl]-3-tert-butyl-5-ethynylbenzene |
| SMILES | C#Cc1cc(CC(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H44O6P2/c1-13-22-14-23(16-24(15-22)26(10,11)12)17-25(33(27,29-18(2)3)30-19(4)5)34(28,31-20(6)7)32-21(8)9/h1,14-16,18-21,25H,17H2,2-12H3 |
| InChIKey | ZHCATCPBHSGHKT-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|