C31H29N5O4 — CID 162660633
ethyl 4-[[2-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]indol-1-yl]acetyl]amino]benzoate (PubChem CID 162660633) has the molecular formula C31H29N5O4 and a molecular weight of 535.60 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]indol-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]indol-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 162660633 |
| Molecular Formula | C31H29N5O4 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | ethyl 4-[[2-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]indol-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2cc(/C=N/c3c(C)n(C)n(-c4ccccc4)c3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H29N5O4/c1-4-40-31(39)22-14-16-24(17-15-22)33-28(37)20-35-19-23(26-12-8-9-13-27(26)35)18-32-29-21(2)34(3)36(30(29)38)25-10-6-5-7-11-25/h5-19H,4,20H2,1-3H3,(H,33,37)/b32-18+ |
| InChIKey | HCYPQMMVEOFNGC-KCSSXMTESA-N |
| XLogP | 5.01 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|