C30H30N4O8 — CID 162661681
tert-butyl 4-[2-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl]piperazine-1-carboxylate (PubChem CID 162661681) has the molecular formula C30H30N4O8 and a molecular weight of 574.59 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162661681 |
| Molecular Formula | C30H30N4O8 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | tert-butyl 4-[2-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitro-1,3-dioxobenzo[de]isoquinolin-6-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c([N+](=O)[O-])cc3c4c(cccc24)C(=O)N(CCc2ccc4c(c2)OCO4)C3=O)CC1 |
| InChI | InChI=1S/C30H30N4O8/c1-30(2,3)42-29(37)32-13-11-31(12-14-32)26-19-5-4-6-20-25(19)21(16-22(26)34(38)39)28(36)33(27(20)35)10-9-18-7-8-23-24(15-18)41-17-40-23/h4-8,15-16H,9-14,17H2,1-3H3 |
| InChIKey | QJZLEYQGJUAHPE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 131.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|