C26H22N4O8 — CID 162665081
methyl (1S,3R)-1-(4-methoxycarbonylphenyl)-2-(5-methyl-4-nitro-1,2-oxazole-3-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 162665081) has the molecular formula C26H22N4O8 and a molecular weight of 518.48 g/mol. Its IUPAC name is methyl (1S,3R)-1-(4-methoxycarbonylphenyl)-2-(5-methyl-4-nitro-1,2-oxazole-3-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3R)-1-(4-methoxycarbonylphenyl)-2-(5-methyl-4-nitro-1,2-oxazole-3-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 162665081 |
| Molecular Formula | C26H22N4O8 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | methyl (1S,3R)-1-(4-methoxycarbonylphenyl)-2-(5-methyl-4-nitro-1,2-oxazole-3-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1ccc([C@H]2c3[nH]c4ccccc4c3C[C@H](C(=O)OC)N2C(=O)c2noc(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H22N4O8/c1-13-22(30(34)35)21(28-38-13)24(31)29-19(26(33)37-3)12-17-16-6-4-5-7-18(16)27-20(17)23(29)14-8-10-15(11-9-14)25(32)36-2/h4-11,19,23,27H,12H2,1-3H3/t19-,23+/m1/s1 |
| InChIKey | DVJHBYSSZLZVAO-XXBNENTESA-N |
| XLogP | 3.49 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|