C11H13NOS — CID 162665088
(2E,4E)-N-ethyl-5-thiophen-3-ylpenta-2,4-dienamide (PubChem CID 162665088) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is (2E,4E)-N-ethyl-5-thiophen-3-ylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-ethyl-5-thiophen-3-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 162665088 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2E,4E)-N-ethyl-5-thiophen-3-ylpenta-2,4-dienamide |
| SMILES | CCNC(=O)/C=C/C=C/c1ccsc1 |
| InChI | InChI=1S/C11H13NOS/c1-2-12-11(13)6-4-3-5-10-7-8-14-9-10/h3-9H,2H2,1H3,(H,12,13)/b5-3+,6-4+ |
| InChIKey | ZEDWEKAPLYKTPC-GGWOSOGESA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|