C25H22BrClN2O3 — CID 162666905
N-[(Z)-1-bromo-3-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 162666905) has the molecular formula C25H22BrClN2O3 and a molecular weight of 513.82 g/mol. Its IUPAC name is N-[(Z)-1-bromo-3-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-[(Z)-1-bromo-3-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 162666905 |
| Molecular Formula | C25H22BrClN2O3 |
| Molecular Weight | 513.82 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | N-[(Z)-1-bromo-3-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)/C(NC(=O)c1ccccc1Cl)=C(/Br)c1ccccc1 |
| InChI | InChI=1S/C25H22BrClN2O3/c26-22(18-11-5-2-6-12-18)23(29-24(31)20-13-7-8-14-21(20)27)25(32)28-19(16-30)15-17-9-3-1-4-10-17/h1-14,19,30H,15-16H2,(H,28,32)(H,29,31)/b23-22-/t19-/m0/s1 |
| InChIKey | NCMRHFZUYHJAPF-ZABCRHKISA-N |
| XLogP | 4.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|