C23H24N3O11P — CID 162669019
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-phenoxyphenyl)methyl]phosphonic acid (PubChem CID 162669019) has the molecular formula C23H24N3O11P and a molecular weight of 549.43 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-phenoxyphenyl)methyl]phosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-phenoxyphenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 162669019 |
| Molecular Formula | C23H24N3O11P |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-phenoxyphenyl)methyl]phosphonic acid |
| SMILES | O=C(NC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)OC(c1cccc(Oc2ccccc2)c1)P(=O)(O)O |
| InChI | InChI=1S/C23H24N3O11P/c27-17-9-10-26(22(30)25-17)20-19(29)18(28)16(36-20)12-24-23(31)37-21(38(32,33)34)13-5-4-8-15(11-13)35-14-6-2-1-3-7-14/h1-11,16,18-21,28-29H,12H2,(H,24,31)(H,25,27,30)(H2,32,33,34)/t16-,18-,19-,20-,21?/m1/s1 |
| InChIKey | DGEMSRIKHTVKJT-LIDDZCSYSA-N |
| XLogP | 0.55 |
| TPSA | 209.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|