C18H22N3O11P — CID 162660446
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-methoxyphenyl)methyl]phosphonic acid (PubChem CID 162660446) has the molecular formula C18H22N3O11P and a molecular weight of 487.36 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-methoxyphenyl)methyl]phosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-methoxyphenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 162660446 |
| Molecular Formula | C18H22N3O11P |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-methoxyphenyl)methyl]phosphonic acid |
| SMILES | COc1cccc(C(OC(=O)NC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C18H22N3O11P/c1-30-10-4-2-3-9(7-10)16(33(27,28)29)32-18(26)19-8-11-13(23)14(24)15(31-11)21-6-5-12(22)20-17(21)25/h2-7,11,13-16,23-24H,8H2,1H3,(H,19,26)(H,20,22,25)(H2,27,28,29)/t11-,13-,14-,15-,16?/m1/s1 |
| InChIKey | UBRBMNJYBVBEIX-ALTVCHKUSA-N |
| XLogP | -1.23 |
| TPSA | 209.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|