C20H26N3O11P — CID 162645865
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-propoxyphenyl)methyl]phosphonic acid (PubChem CID 162645865) has the molecular formula C20H26N3O11P and a molecular weight of 515.41 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-propoxyphenyl)methyl]phosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-propoxyphenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 162645865 |
| Molecular Formula | C20H26N3O11P |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylcarbamoyloxy-(3-propoxyphenyl)methyl]phosphonic acid |
| SMILES | CCCOc1cccc(C(OC(=O)NC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C20H26N3O11P/c1-2-8-32-12-5-3-4-11(9-12)18(35(29,30)31)34-20(28)21-10-13-15(25)16(26)17(33-13)23-7-6-14(24)22-19(23)27/h3-7,9,13,15-18,25-26H,2,8,10H2,1H3,(H,21,28)(H,22,24,27)(H2,29,30,31)/t13-,15-,16-,17-,18?/m1/s1 |
| InChIKey | PLZDLIXNBQSXBA-XWEABGILSA-N |
| XLogP | -0.45 |
| TPSA | 209.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|