C13H14INO4 — CID 162671308
ethyl (4R,5R)-2-(2-hydroxy-5-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 162671308) has the molecular formula C13H14INO4 and a molecular weight of 375.16 g/mol. Its IUPAC name is ethyl (4R,5R)-2-(2-hydroxy-5-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl (4R,5R)-2-(2-hydroxy-5-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 162671308 |
| Molecular Formula | C13H14INO4 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | ethyl (4R,5R)-2-(2-hydroxy-5-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N=C(c2cc(I)ccc2O)O[C@@H]1C |
| InChI | InChI=1S/C13H14INO4/c1-3-18-13(17)11-7(2)19-12(15-11)9-6-8(14)4-5-10(9)16/h4-7,11,16H,3H2,1-2H3/t7-,11-/m1/s1 |
| InChIKey | BHYHHZQEEPHZGB-RDDDGLTNSA-N |
| XLogP | 2.09 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|