C15H15F3N4O4 — CID 162673824
N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 162673824) has the molecular formula C15H15F3N4O4 and a molecular weight of 372.30 g/mol. Its IUPAC name is N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 162673824 |
| Molecular Formula | C15H15F3N4O4 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CC1(CNc2ccc(OC(F)(F)F)cc2)CCn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C15H15F3N4O4/c1-14(6-7-21-8-12(22(23)24)20-13(21)26-14)9-19-10-2-4-11(5-3-10)25-15(16,17)18/h2-5,8,19H,6-7,9H2,1H3 |
| InChIKey | BXJKRGSHQJJBHZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|