C27H21ClN6O4 — CID 162673873
2-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1,3-dihydroxy-N-(pyridine-4-carbonylimino)isoindole-5-carboxamide (PubChem CID 162673873) has the molecular formula C27H21ClN6O4 and a molecular weight of 528.96 g/mol. Its IUPAC name is 2-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1,3-dihydroxy-N-(pyridine-4-carbonylimino)isoindole-5-carboxamide.
| Compound Name | 2-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1,3-dihydroxy-N-(pyridine-4-carbonylimino)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 162673873 |
| Molecular Formula | C27H21ClN6O4 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 2-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1,3-dihydroxy-N-(pyridine-4-carbonylimino)isoindole-5-carboxamide |
| SMILES | O=C(/N=N/C(=O)c1ccc2c(O)n(CCCNc3ccnc4cc(Cl)ccc34)c(O)c2c1)c1ccncc1 |
| InChI | InChI=1S/C27H21ClN6O4/c28-18-3-5-20-22(8-12-31-23(20)15-18)30-9-1-13-34-26(37)19-4-2-17(14-21(19)27(34)38)25(36)33-32-24(35)16-6-10-29-11-7-16/h2-8,10-12,14-15,37-38H,1,9,13H2,(H,30,31)/b33-32+ |
| InChIKey | OAIOFEVPLXOFJW-ULIFNZDWSA-N |
| XLogP | 5.58 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|