C17H24O5 — CID 162680217
methyl 5-hydroxy-4-methyl-7-pentyl-3,4-dihydro-2H-chromene-6-carboperoxoate (PubChem CID 162680217) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl 5-hydroxy-4-methyl-7-pentyl-3,4-dihydro-2H-chromene-6-carboperoxoate.
| Compound Name | methyl 5-hydroxy-4-methyl-7-pentyl-3,4-dihydro-2H-chromene-6-carboperoxoate |
|---|---|
| PubChem CID | 162680217 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl 5-hydroxy-4-methyl-7-pentyl-3,4-dihydro-2H-chromene-6-carboperoxoate |
| SMILES | CCCCCc1cc2c(c(O)c1C(=O)OOC)C(C)CCO2 |
| InChI | InChI=1S/C17H24O5/c1-4-5-6-7-12-10-13-14(11(2)8-9-21-13)16(18)15(12)17(19)22-20-3/h10-11,18H,4-9H2,1-3H3 |
| InChIKey | UNAASRBKSZFIKS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|