C22H30O3 — CID 130436947
1-[(1R,9R,14R)-3-hydroxy-13,13-dimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-trien-4-yl]ethanone (PubChem CID 130436947) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[(1R,9R,14R)-3-hydroxy-13,13-dimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-trien-4-yl]ethanone.
| Compound Name | 1-[(1R,9R,14R)-3-hydroxy-13,13-dimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-trien-4-yl]ethanone |
|---|---|
| PubChem CID | 130436947 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[(1R,9R,14R)-3-hydroxy-13,13-dimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-trien-4-yl]ethanone |
| SMILES | CCCCCc1cc2c(c(O)c1C(C)=O)[C@@H]1[C@H]3C(CC[C@H]3O2)C1(C)C |
| InChI | InChI=1S/C22H30O3/c1-5-6-7-8-13-11-16-19(21(24)17(13)12(2)23)20-18-14(22(20,3)4)9-10-15(18)25-16/h11,14-15,18,20,24H,5-10H2,1-4H3/t14?,15-,18+,20+/m1/s1 |
| InChIKey | GWKOFNGUPRKDSS-JTKYFQSDSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|