C19H15F5N2O3S — CID 162685671
2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid (PubChem CID 162685671) has the molecular formula C19H15F5N2O3S and a molecular weight of 446.40 g/mol. Its IUPAC name is 2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162685671 |
| Molecular Formula | C19H15F5N2O3S |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1cc(-c2ccc(S(F)(F)(F)(F)F)cc2)c2c(c1C#N)CCO2)C(=O)O |
| InChI | InChI=1S/C19H15F5N2O3S/c1-11(19(27)28)10-26-17-8-15(18-14(6-7-29-18)16(17)9-25)12-2-4-13(5-3-12)30(20,21,22,23)24/h2-5,8,26H,1,6-7,10H2,(H,27,28) |
| InChIKey | PTWVUQFTKVQLPQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|