C24H26N2O4S — CID 162686931
(4aS,7aR)-1-[(2,4-dimethoxyphenyl)methyl]-4-hydroxy-2-oxo-N-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-3-carbothioamide (PubChem CID 162686931) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is (4aS,7aR)-1-[(2,4-dimethoxyphenyl)methyl]-4-hydroxy-2-oxo-N-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | (4aS,7aR)-1-[(2,4-dimethoxyphenyl)methyl]-4-hydroxy-2-oxo-N-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 162686931 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (4aS,7aR)-1-[(2,4-dimethoxyphenyl)methyl]-4-hydroxy-2-oxo-N-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-3-carbothioamide |
| SMILES | COc1ccc(CN2C(=O)C(C(=S)Nc3ccccc3)=C(O)[C@H]3CCC[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O4S/c1-29-17-12-11-15(20(13-17)30-2)14-26-19-10-6-9-18(19)22(27)21(24(26)28)23(31)25-16-7-4-3-5-8-16/h3-5,7-8,11-13,18-19,27H,6,9-10,14H2,1-2H3,(H,25,31)/t18-,19+/m0/s1 |
| InChIKey | XEHFTWWDHUDEJU-RBUKOAKNSA-N |
| XLogP | 4.47 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|