C21H20F4N6O2 — CID 162687311
N-[2-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-fluoro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,2,2-trifluoroacetamide (PubChem CID 162687311) has the molecular formula C21H20F4N6O2 and a molecular weight of 464.42 g/mol. Its IUPAC name is N-[2-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-fluoro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-fluoro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162687311 |
| Molecular Formula | C21H20F4N6O2 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[2-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-fluoro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)Nc1cc(C#Cc2nc(F)cc(N3CCN(C)CC3)c2NC(=O)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C21H20F4N6O2/c1-13(32)27-18-11-14(5-6-26-18)3-4-15-19(29-20(33)21(23,24)25)16(12-17(22)28-15)31-9-7-30(2)8-10-31/h5-6,11-12H,7-10H2,1-2H3,(H,29,33)(H,26,27,32) |
| InChIKey | ONAIXPQKIYRVEP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|