C19H16F3N5O4 — CID 162687313
N-[4-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-[(3S)-oxolan-3-yl]oxypyrimidin-5-yl]-2,2,2-trifluoroacetamide (PubChem CID 162687313) has the molecular formula C19H16F3N5O4 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-[4-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-[(3S)-oxolan-3-yl]oxypyrimidin-5-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-[(3S)-oxolan-3-yl]oxypyrimidin-5-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162687313 |
| Molecular Formula | C19H16F3N5O4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[4-[2-(2-acetamido-4-pyridinyl)ethynyl]-6-[(3S)-oxolan-3-yl]oxypyrimidin-5-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)Nc1cc(C#Cc2ncnc(O[C@H]3CCOC3)c2NC(=O)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C19H16F3N5O4/c1-11(28)26-15-8-12(4-6-23-15)2-3-14-16(27-18(29)19(20,21)22)17(25-10-24-14)31-13-5-7-30-9-13/h4,6,8,10,13H,5,7,9H2,1H3,(H,27,29)(H,23,26,28)/t13-/m0/s1 |
| InChIKey | MYMPJJWBRZJLSX-ZDUSSCGKSA-N |
| XLogP | 1.90 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|