C17H20F3NO2 — CID 162687901
N-[3-(5,5,5-trifluoropentoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 162687901) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[3-(5,5,5-trifluoropentoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-[3-(5,5,5-trifluoropentoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 162687901 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[3-(5,5,5-trifluoropentoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)C(OCCCCC(F)(F)F)CC2 |
| InChI | InChI=1S/C17H20F3NO2/c1-2-16(22)21-13-7-5-12-6-8-15(14(12)11-13)23-10-4-3-9-17(18,19)20/h2,5,7,11,15H,1,3-4,6,8-10H2,(H,21,22) |
| InChIKey | NNGNSICZXITLTD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|