C15H16F3NO2 — CID 175411868
N-[3-(1,2,3-trifluoropropoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 175411868) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-[3-(1,2,3-trifluoropropoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-[3-(1,2,3-trifluoropropoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175411868 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[3-(1,2,3-trifluoropropoxy)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)C(OC(F)C(F)CF)CC2 |
| InChI | InChI=1S/C15H16F3NO2/c1-2-14(20)19-10-5-3-9-4-6-13(11(9)7-10)21-15(18)12(17)8-16/h2-3,5,7,12-13,15H,1,4,6,8H2,(H,19,20) |
| InChIKey | UXVUYUGEPRHTAZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|