C7H12ClN3 — CID 162690628
(1R,2R,4S)-2-amino-7-azabicyclo[2.2.1]heptane-7-carbonitrile;hydrochloride (PubChem CID 162690628) has the molecular formula C7H12ClN3 and a molecular weight of 173.65 g/mol. Its IUPAC name is (1R,2R,4S)-2-amino-7-azabicyclo[2.2.1]heptane-7-carbonitrile;hydrochloride.
| Compound Name | (1R,2R,4S)-2-amino-7-azabicyclo[2.2.1]heptane-7-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 162690628 |
| Molecular Formula | C7H12ClN3 |
| Molecular Weight | 173.65 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (1R,2R,4S)-2-amino-7-azabicyclo[2.2.1]heptane-7-carbonitrile;hydrochloride |
| SMILES | Cl.N#CN1[C@H]2CC[C@@H]1[C@H](N)C2 |
| InChI | InChI=1S/C7H11N3.ClH/c8-4-10-5-1-2-7(10)6(9)3-5;/h5-7H,1-3,9H2;1H/t5-,6+,7+;/m0./s1 |
| InChIKey | LGRICGFGYSZIPV-VWZUFWLJSA-N |
| XLogP | 0.45 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.65 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|