C21H37N3O4 — CID 162700243
tert-butyl 3-[2-acetamido-1-(tert-butylamino)-1-oxohex-5-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 162700243) has the molecular formula C21H37N3O4 and a molecular weight of 395.54 g/mol. Its IUPAC name is tert-butyl 3-[2-acetamido-1-(tert-butylamino)-1-oxohex-5-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-acetamido-1-(tert-butylamino)-1-oxohex-5-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162700243 |
| Molecular Formula | C21H37N3O4 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | tert-butyl 3-[2-acetamido-1-(tert-butylamino)-1-oxohex-5-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C=CCCC(NC(C)=O)(C(=O)NC(C)(C)C)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H37N3O4/c1-9-10-12-21(22-15(2)25,17(26)23-19(3,4)5)16-11-13-24(14-16)18(27)28-20(6,7)8/h9,16H,1,10-14H2,2-8H3,(H,22,25)(H,23,26) |
| InChIKey | GSRBSKQAZNJEMA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|