C17H25N2O4W- — CID 59847781
tert-butyl (2S)-2-[[(2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]pyrrolidin-4-ide-1-carboxylate;tungsten (PubChem CID 59847781) has the molecular formula C17H25N2O4W- and a molecular weight of 505.24 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]pyrrolidin-4-ide-1-carboxylate;tungsten.
| Compound Name | tert-butyl (2S)-2-[[(2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]pyrrolidin-4-ide-1-carboxylate;tungsten |
|---|---|
| PubChem CID | 59847781 |
| Molecular Formula | C17H25N2O4W- |
| Molecular Weight | 505.24 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]pyrrolidin-4-ide-1-carboxylate;tungsten |
| SMILES | C=C[C@@H]1CC1(NC(=O)[C@@H]1C[CH-]CN1C(=O)OC(C)(C)C)C(C)=O.[W] |
| InChI | InChI=1S/C17H25N2O4.W/c1-6-12-10-17(12,11(2)20)18-14(21)13-8-7-9-19(13)15(22)23-16(3,4)5;/h6-7,12-13H,1,8-10H2,2-5H3,(H,18,21);/q-1;/t12-,13+,17?;/m1./s1 |
| InChIKey | XSOYHXDJAAMMCO-JAMJLSRGSA-N |
| XLogP | 1.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|