C30H24N4O3PtS — CID 162702733
N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,3-bis[(2-hydroxyphenyl)methylideneamino]propanamide;platinum (PubChem CID 162702733) has the molecular formula C30H24N4O3PtS and a molecular weight of 715.69 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,3-bis[(2-hydroxyphenyl)methylideneamino]propanamide;platinum.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,3-bis[(2-hydroxyphenyl)methylideneamino]propanamide;platinum |
|---|---|
| PubChem CID | 162702733 |
| Molecular Formula | C30H24N4O3PtS |
| Molecular Weight | 715.69 g/mol |
| Exact Mass | 715.12 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,3-bis[(2-hydroxyphenyl)methylideneamino]propanamide;platinum |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cc1)C(C/N=C/c1ccccc1O)/N=C/c1ccccc1O.[Pt] |
| InChI | InChI=1S/C30H24N4O3S.Pt/c35-26-10-4-1-7-21(26)17-31-19-25(32-18-22-8-2-5-11-27(22)36)29(37)33-23-15-13-20(14-16-23)30-34-24-9-3-6-12-28(24)38-30;/h1-18,25,35-36H,19H2,(H,33,37);/b31-17+,32-18+; |
| InChIKey | OPSHLGNEAZSKLD-UIEZAYFCSA-N |
| XLogP | 5.92 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|