C28H32O5 — CID 162705724
prop-2-enyl 8-(4-benzyl-5-methylidene-3-oxo-10-oxatricyclo[5.2.1.02,6]dec-8-en-1-yl)-6-oxooctanoate (PubChem CID 162705724) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is prop-2-enyl 8-(4-benzyl-5-methylidene-3-oxo-10-oxatricyclo[5.2.1.02,6]dec-8-en-1-yl)-6-oxooctanoate.
| Compound Name | prop-2-enyl 8-(4-benzyl-5-methylidene-3-oxo-10-oxatricyclo[5.2.1.02,6]dec-8-en-1-yl)-6-oxooctanoate |
|---|---|
| PubChem CID | 162705724 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | prop-2-enyl 8-(4-benzyl-5-methylidene-3-oxo-10-oxatricyclo[5.2.1.02,6]dec-8-en-1-yl)-6-oxooctanoate |
| SMILES | C=CCOC(=O)CCCCC(=O)CCC12C=CC(O1)C1C(=C)C(Cc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C28H32O5/c1-3-17-32-24(30)12-8-7-11-21(29)13-15-28-16-14-23(33-28)25-19(2)22(27(31)26(25)28)18-20-9-5-4-6-10-20/h3-6,9-10,14,16,22-23,25-26H,1-2,7-8,11-13,15,17-18H2 |
| InChIKey | KIYMNELBNKYMIL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|