C28H39N9O2SSi — CID 162715739
3-(4-methylpiperazin-1-yl)-6-[[4-[2-[(sulfinoamino)methyl]anilino]-5-(2-trimethylsilylethyl)pyrimidin-2-yl]amino]-1H-indazole (PubChem CID 162715739) has the molecular formula C28H39N9O2SSi and a molecular weight of 593.83 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-6-[[4-[2-[(sulfinoamino)methyl]anilino]-5-(2-trimethylsilylethyl)pyrimidin-2-yl]amino]-1H-indazole.
| Compound Name | 3-(4-methylpiperazin-1-yl)-6-[[4-[2-[(sulfinoamino)methyl]anilino]-5-(2-trimethylsilylethyl)pyrimidin-2-yl]amino]-1H-indazole |
|---|---|
| PubChem CID | 162715739 |
| Molecular Formula | C28H39N9O2SSi |
| Molecular Weight | 593.83 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-6-[[4-[2-[(sulfinoamino)methyl]anilino]-5-(2-trimethylsilylethyl)pyrimidin-2-yl]amino]-1H-indazole |
| SMILES | CN1CCN(c2n[nH]c3cc(Nc4ncc(CC[Si](C)(C)C)c(Nc5ccccc5CNS(=O)O)n4)ccc23)CC1 |
| InChI | InChI=1S/C28H39N9O2SSi/c1-36-12-14-37(15-13-36)27-23-10-9-22(17-25(23)34-35-27)31-28-29-18-21(11-16-41(2,3)4)26(33-28)32-24-8-6-5-7-20(24)19-30-40(38)39/h5-10,17-18,30H,11-16,19H2,1-4H3,(H,34,35)(H,38,39)(H2,29,31,32,33) |
| InChIKey | SZPSLHJFIUODBK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|