C17H21Cl2N3O2S — CID 162716570
N-[(4-chlorophenyl)methyl]-N-[(5-nitrothiophen-2-yl)methyl]-1-[(3R)-pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 162716570) has the molecular formula C17H21Cl2N3O2S and a molecular weight of 402.35 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-[(5-nitrothiophen-2-yl)methyl]-1-[(3R)-pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-[(5-nitrothiophen-2-yl)methyl]-1-[(3R)-pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 162716570 |
| Molecular Formula | C17H21Cl2N3O2S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-[(5-nitrothiophen-2-yl)methyl]-1-[(3R)-pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CN(Cc2ccc(Cl)cc2)C[C@@H]2CCNC2)s1 |
| InChI | InChI=1S/C17H20ClN3O2S.ClH/c18-15-3-1-13(2-4-15)10-20(11-14-7-8-19-9-14)12-16-5-6-17(24-16)21(22)23;/h1-6,14,19H,7-12H2;1H/t14-;/m1./s1 |
| InChIKey | JCLWTTWOCLKEAB-PFEQFJNWSA-N |
| XLogP | 4.34 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|