C28H25F2N3OS — CID 162717604
N-(2-ethylsulfanylphenyl)-4,4-bis(6-fluoro-1H-indol-3-yl)butanamide (PubChem CID 162717604) has the molecular formula C28H25F2N3OS and a molecular weight of 489.59 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-4,4-bis(6-fluoro-1H-indol-3-yl)butanamide.
| Compound Name | N-(2-ethylsulfanylphenyl)-4,4-bis(6-fluoro-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 162717604 |
| Molecular Formula | C28H25F2N3OS |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-4,4-bis(6-fluoro-1H-indol-3-yl)butanamide |
| SMILES | CCSc1ccccc1NC(=O)CCC(c1c[nH]c2cc(F)ccc12)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C28H25F2N3OS/c1-2-35-27-6-4-3-5-24(27)33-28(34)12-11-19(22-15-31-25-13-17(29)7-9-20(22)25)23-16-32-26-14-18(30)8-10-21(23)26/h3-10,13-16,19,31-32H,2,11-12H2,1H3,(H,33,34) |
| InChIKey | AVQDTAOEZYDJCT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |