C19H22Cl2N2O — CID 162721237
(2S)-N-[2-[4-(3,4-dichlorophenyl)phenyl]ethyl]-2-(methylamino)butanamide (PubChem CID 162721237) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is (2S)-N-[2-[4-(3,4-dichlorophenyl)phenyl]ethyl]-2-(methylamino)butanamide.
| Compound Name | (2S)-N-[2-[4-(3,4-dichlorophenyl)phenyl]ethyl]-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 162721237 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S)-N-[2-[4-(3,4-dichlorophenyl)phenyl]ethyl]-2-(methylamino)butanamide |
| SMILES | CC[C@H](NC)C(=O)NCCc1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-3-18(22-2)19(24)23-11-10-13-4-6-14(7-5-13)15-8-9-16(20)17(21)12-15/h4-9,12,18,22H,3,10-11H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | CUKWKCARRSCQNU-SFHVURJKSA-N |
| XLogP | 4.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |