C25H21F3N4O4 — CID 162723727
1-[(4-methoxyphenyl)methyl]-3-[3-oxo-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 162723727) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[3-oxo-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[3-oxo-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162723727 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[3-oxo-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CCC(N3Cc4cc(-c5cc(C(F)(F)F)[nH]n5)ccc4C3=O)C2=O)cc1 |
| InChI | InChI=1S/C25H21F3N4O4/c1-36-17-5-2-14(3-6-17)12-32-22(33)9-8-20(24(32)35)31-13-16-10-15(4-7-18(16)23(31)34)19-11-21(30-29-19)25(26,27)28/h2-7,10-11,20H,8-9,12-13H2,1H3,(H,29,30) |
| InChIKey | BPHJJEYVNNTGAC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|