C11H10ClF2NO2 — CID 162728834
2-chloro-5,5-difluorospiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane] (PubChem CID 162728834) has the molecular formula C11H10ClF2NO2 and a molecular weight of 261.65 g/mol. Its IUPAC name is 2-chloro-5,5-difluorospiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane].
| Compound Name | 2-chloro-5,5-difluorospiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane] |
|---|---|
| PubChem CID | 162728834 |
| Molecular Formula | C11H10ClF2NO2 |
| Molecular Weight | 261.65 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-chloro-5,5-difluorospiro[6H-pyrano[3,4-b]pyridine-8,3'-oxolane] |
| SMILES | FC1(F)COC2(CCOC2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C11H10ClF2NO2/c12-8-2-1-7-9(15-8)10(3-4-16-5-10)17-6-11(7,13)14/h1-2H,3-6H2 |
| InChIKey | GKLXSXORCLWXFK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|