C15H18ClF2NO4 — CID 162728847
2-chloro-4-[3-(difluoromethoxy)propoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] (PubChem CID 162728847) has the molecular formula C15H18ClF2NO4 and a molecular weight of 349.76 g/mol. Its IUPAC name is 2-chloro-4-[3-(difluoromethoxy)propoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane].
| Compound Name | 2-chloro-4-[3-(difluoromethoxy)propoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
|---|---|
| PubChem CID | 162728847 |
| Molecular Formula | C15H18ClF2NO4 |
| Molecular Weight | 349.76 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-chloro-4-[3-(difluoromethoxy)propoxy]spiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
| SMILES | FC(F)OCCCOc1cc(Cl)nc2c1CCOC21CCOC1 |
| InChI | InChI=1S/C15H18ClF2NO4/c16-12-8-11(21-4-1-5-22-14(17)18)10-2-6-23-15(13(10)19-12)3-7-20-9-15/h8,14H,1-7,9H2 |
| InChIKey | ILBJJEUOQUISIK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|