C11H11ClF3NO5S — CID 139464743
[2-chloro-6-(3-methoxyoxolan-3-yl)-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 139464743) has the molecular formula C11H11ClF3NO5S and a molecular weight of 361.73 g/mol. Its IUPAC name is [2-chloro-6-(3-methoxyoxolan-3-yl)-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-chloro-6-(3-methoxyoxolan-3-yl)-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139464743 |
| Molecular Formula | C11H11ClF3NO5S |
| Molecular Weight | 361.73 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | [2-chloro-6-(3-methoxyoxolan-3-yl)-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | COC1(c2cc(OS(=O)(=O)C(F)(F)F)cc(Cl)n2)CCOC1 |
| InChI | InChI=1S/C11H11ClF3NO5S/c1-19-10(2-3-20-6-10)8-4-7(5-9(12)16-8)21-22(17,18)11(13,14)15/h4-5H,2-3,6H2,1H3 |
| InChIKey | GCRVFKVWOWTZOI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|