C12H13ClF3NO3 — CID 170351306
2-chloro-6-(3-methoxyoxolan-3-yl)-4-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 170351306) has the molecular formula C12H13ClF3NO3 and a molecular weight of 311.69 g/mol. Its IUPAC name is 2-chloro-6-(3-methoxyoxolan-3-yl)-4-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 2-chloro-6-(3-methoxyoxolan-3-yl)-4-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 170351306 |
| Molecular Formula | C12H13ClF3NO3 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-chloro-6-(3-methoxyoxolan-3-yl)-4-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | COC1(c2cc(OCC(F)(F)F)cc(Cl)n2)CCOC1 |
| InChI | InChI=1S/C12H13ClF3NO3/c1-18-11(2-3-19-6-11)9-4-8(5-10(13)17-9)20-7-12(14,15)16/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | RRYIIDSFKLFJDF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|